About N-(3-methyl-1,3-thiazol-2-ylidene)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide
N-(3-methyl-1,3-thiazol-2-ylidene)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 31287307) has the molecular formula C10H9F3N4OS
and a molecular weight of 290.27 g/mol. Its IUPAC name is N-(3-methyl-1,3-thiazol-2-ylidene)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
Molecular Properties
| Compound Name | N-(3-methyl-1,3-thiazol-2-ylidene)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| PubChem CID | 31287307 |
| Molecular Formula | C10H9F3N4OS |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | N-(3-methyl-1,3-thiazol-2-ylidene)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | Cn1ccs/c1=N/C(=O)Cn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H9F3N4OS/c1-16-4-5-19-9(16)14-8(18)6-17-3-2-7(15-17)10(11,12)13/h2-5H,6H2,1H3/b14-9+ |
| InChIKey | PYKDGFUWPBOKCZ-NTEUORMPSA-N |
| XLogP | 1.43 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-methyl-1,3-thiazol-2-ylidene)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methyl-1,3-thiazol-2-ylidene)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide?
The IUPAC name of N-(3-methyl-1,3-thiazol-2-ylidene)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (CID 31287307) is N-(3-methyl-1,3-thiazol-2-ylidene)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
What is the SMILES notation for N-(3-methyl-1,3-thiazol-2-ylidene)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide?
The canonical SMILES for N-(3-methyl-1,3-thiazol-2-ylidene)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide is Cn1ccs/c1=N/C(=O)Cn1ccc(C(F)(F)F)n1.
What is the InChIKey of N-(3-methyl-1,3-thiazol-2-ylidene)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide?
The InChIKey is PYKDGFUWPBOKCZ-NTEUORMPSA-N. The full InChI is InChI=1S/C10H9F3N4OS/c1-16-4-5-19-9(16)14-8(18)6-17-3-2-7(15-17)10(11,12)13/h2-5H,6H2,1H3/b14-9+.
What are the key properties of N-(3-methyl-1,3-thiazol-2-ylidene)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide?
N-(3-methyl-1,3-thiazol-2-ylidene)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide has a molecular weight of 290.27 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methyl-1,3-thiazol-2-ylidene)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide is sourced from PubChem (CID 31287307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).