C16H25N5O2 — CID 3128957
6-ethoxy-2-N-(furan-2-ylmethyl)-4-N-hexyl-1,3,5-triazine-2,4-diamine (PubChem CID 3128957) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 6-ethoxy-2-N-(furan-2-ylmethyl)-4-N-hexyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethoxy-2-N-(furan-2-ylmethyl)-4-N-hexyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3128957 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 6-ethoxy-2-N-(furan-2-ylmethyl)-4-N-hexyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCNc1nc(NCc2ccco2)nc(OCC)n1 |
| InChI | InChI=1S/C16H25N5O2/c1-3-5-6-7-10-17-14-19-15(21-16(20-14)22-4-2)18-12-13-9-8-11-23-13/h8-9,11H,3-7,10,12H2,1-2H3,(H2,17,18,19,20,21) |
| InChIKey | IOUSNEFHJKZMFR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|