C15H14N2O2 — CID 3129173
1-(8-methoxy-4-methyl-2,3-diazatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaen-2-yl)ethanone (PubChem CID 3129173) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-(8-methoxy-4-methyl-2,3-diazatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaen-2-yl)ethanone.
| Compound Name | 1-(8-methoxy-4-methyl-2,3-diazatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaen-2-yl)ethanone |
|---|---|
| PubChem CID | 3129173 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-(8-methoxy-4-methyl-2,3-diazatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaen-2-yl)ethanone |
| SMILES | COc1ccc2c3c(cccc13)N(C(C)=O)N=C2C |
| InChI | InChI=1S/C15H14N2O2/c1-9-11-7-8-14(19-3)12-5-4-6-13(15(11)12)17(16-9)10(2)18/h4-8H,1-3H3 |
| InChIKey | IUFOVZYGTYYQML-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |