About N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]pentanamide
N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]pentanamide (PubChem CID 3129250) has the molecular formula C23H26N2O4
and a molecular weight of 394.47 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]pentanamide.
Molecular Properties
| Compound Name | N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]pentanamide |
| PubChem CID | 3129250 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]pentanamide |
| SMILES | CCCCC(=O)NC(c1ccc(OC)c(OC)c1)c1ccc2cccnc2c1O |
| InChI | InChI=1S/C23H26N2O4/c1-4-5-8-20(26)25-21(16-10-12-18(28-2)19(14-16)29-3)17-11-9-15-7-6-13-24-22(15)23(17)27/h6-7,9-14,21,27H,4-5,8H2,1-3H3,(H,25,26) |
| InChIKey | VVRFQSOMYLFRRY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]pentanamide?
The IUPAC name of N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]pentanamide (CID 3129250) is N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]pentanamide.
What is the SMILES notation for N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]pentanamide?
The canonical SMILES for N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]pentanamide is CCCCC(=O)NC(c1ccc(OC)c(OC)c1)c1ccc2cccnc2c1O.
What is the InChIKey of N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]pentanamide?
The InChIKey is VVRFQSOMYLFRRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O4/c1-4-5-8-20(26)25-21(16-10-12-18(28-2)19(14-16)29-3)17-11-9-15-7-6-13-24-22(15)23(17)27/h6-7,9-14,21,27H,4-5,8H2,1-3H3,(H,25,26).
What are the key properties of N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]pentanamide?
N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]pentanamide has a molecular weight of 394.47 g/mol, XLogP of 4.35, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]pentanamide is sourced from PubChem (CID 3129250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).