About propyl 2-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]acetate
propyl 2-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]acetate (PubChem CID 3129288) has the molecular formula C16H14N4O3S
and a molecular weight of 342.38 g/mol. Its IUPAC name is propyl 2-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]acetate.
Molecular Properties
| Compound Name | propyl 2-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]acetate |
| PubChem CID | 3129288 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | propyl 2-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]acetate |
| SMILES | CCCOC(=O)CSc1nc(N)c(C#N)c(-c2ccco2)c1C#N |
| InChI | InChI=1S/C16H14N4O3S/c1-2-5-23-13(21)9-24-16-11(8-18)14(12-4-3-6-22-12)10(7-17)15(19)20-16/h3-4,6H,2,5,9H2,1H3,(H2,19,20) |
| InChIKey | WSBYLVCISLWEDH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 125.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze propyl 2-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]acetate?
The IUPAC name of propyl 2-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]acetate (CID 3129288) is propyl 2-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]acetate.
What is the SMILES notation for propyl 2-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]acetate?
The canonical SMILES for propyl 2-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]acetate is CCCOC(=O)CSc1nc(N)c(C#N)c(-c2ccco2)c1C#N.
What is the InChIKey of propyl 2-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]acetate?
The InChIKey is WSBYLVCISLWEDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O3S/c1-2-5-23-13(21)9-24-16-11(8-18)14(12-4-3-6-22-12)10(7-17)15(19)20-16/h3-4,6H,2,5,9H2,1H3,(H2,19,20).
What are the key properties of propyl 2-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]acetate?
propyl 2-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]acetate has a molecular weight of 342.38 g/mol, XLogP of 2.71, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]acetate is sourced from PubChem (CID 3129288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).