C38H51ClO3 — CID 3129313
methyl 10-[(4-chlorophenyl)methylidene]-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylate (PubChem CID 3129313) has the molecular formula C38H51ClO3 and a molecular weight of 591.28 g/mol. Its IUPAC name is methyl 10-[(4-chlorophenyl)methylidene]-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylate.
| Compound Name | methyl 10-[(4-chlorophenyl)methylidene]-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylate |
|---|---|
| PubChem CID | 3129313 |
| Molecular Formula | C38H51ClO3 |
| Molecular Weight | 591.28 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | methyl 10-[(4-chlorophenyl)methylidene]-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylate |
| SMILES | C=C(C)C1CCC2(C(=O)OC)CCC3(C)C(CCC4C5(C)CC(=Cc6ccc(Cl)cc6)C(=O)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C38H51ClO3/c1-23(2)27-15-18-38(33(41)42-8)20-19-36(6)28(31(27)38)13-14-30-35(5)22-25(21-24-9-11-26(39)12-10-24)32(40)34(3,4)29(35)16-17-37(30,36)7/h9-12,21,27-31H,1,13-20,22H2,2-8H3 |
| InChIKey | PBFZNBCIOYZGPX-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.28 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|