About dipropan-2-yl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate
dipropan-2-yl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate (PubChem CID 3129707) has the molecular formula C21H28O6
and a molecular weight of 376.45 g/mol. Its IUPAC name is dipropan-2-yl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate.
Molecular Properties
| Compound Name | dipropan-2-yl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate |
| PubChem CID | 3129707 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | dipropan-2-yl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate |
| SMILES | CC(C)OC(=O)C1C(=O)CC(C)(O)C(C(=O)OC(C)C)C1c1ccccc1 |
| InChI | InChI=1S/C21H28O6/c1-12(2)26-19(23)17-15(22)11-21(5,25)18(20(24)27-13(3)4)16(17)14-9-7-6-8-10-14/h6-10,12-13,16-18,25H,11H2,1-5H3 |
| InChIKey | FMJOKPRBXJEFND-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dipropan-2-yl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate?
The IUPAC name of dipropan-2-yl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate (CID 3129707) is dipropan-2-yl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate.
What is the SMILES notation for dipropan-2-yl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate?
The canonical SMILES for dipropan-2-yl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate is CC(C)OC(=O)C1C(=O)CC(C)(O)C(C(=O)OC(C)C)C1c1ccccc1.
What is the InChIKey of dipropan-2-yl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate?
The InChIKey is FMJOKPRBXJEFND-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O6/c1-12(2)26-19(23)17-15(22)11-21(5,25)18(20(24)27-13(3)4)16(17)14-9-7-6-8-10-14/h6-10,12-13,16-18,25H,11H2,1-5H3.
What are the key properties of dipropan-2-yl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate?
dipropan-2-yl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate has a molecular weight of 376.45 g/mol, XLogP of 2.63, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate is sourced from PubChem (CID 3129707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).