About 1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-N-(2-piperazin-1-ylethyl)ethanamine
1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-N-(2-piperazin-1-ylethyl)ethanamine (PubChem CID 3129766) has the molecular formula C23H39N3
and a molecular weight of 357.59 g/mol. Its IUPAC name is 1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-N-(2-piperazin-1-ylethyl)ethanamine.
Molecular Properties
| Compound Name | 1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-N-(2-piperazin-1-ylethyl)ethanamine |
| PubChem CID | 3129766 |
| Molecular Formula | C23H39N3 |
| Molecular Weight | 357.59 g/mol |
| Exact Mass | 357.31 |
| IUPAC Name | 1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-N-(2-piperazin-1-ylethyl)ethanamine |
| SMILES | CC(NCCN1CCNCC1)c1cc(C(C)(C)C)cc2c1CCC2(C)C |
| InChI | InChI=1S/C23H39N3/c1-17(25-11-14-26-12-9-24-10-13-26)20-15-18(22(2,3)4)16-21-19(20)7-8-23(21,5)6/h15-17,24-25H,7-14H2,1-6H3 |
| InChIKey | UYHZWEKCQRKFCH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-N-(2-piperazin-1-ylethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-N-(2-piperazin-1-ylethyl)ethanamine?
The IUPAC name of 1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-N-(2-piperazin-1-ylethyl)ethanamine (CID 3129766) is 1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-N-(2-piperazin-1-ylethyl)ethanamine.
What is the SMILES notation for 1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-N-(2-piperazin-1-ylethyl)ethanamine?
The canonical SMILES for 1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-N-(2-piperazin-1-ylethyl)ethanamine is CC(NCCN1CCNCC1)c1cc(C(C)(C)C)cc2c1CCC2(C)C.
What is the InChIKey of 1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-N-(2-piperazin-1-ylethyl)ethanamine?
The InChIKey is UYHZWEKCQRKFCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H39N3/c1-17(25-11-14-26-12-9-24-10-13-26)20-15-18(22(2,3)4)16-21-19(20)7-8-23(21,5)6/h15-17,24-25H,7-14H2,1-6H3.
What are the key properties of 1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-N-(2-piperazin-1-ylethyl)ethanamine?
1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-N-(2-piperazin-1-ylethyl)ethanamine has a molecular weight of 357.59 g/mol, XLogP of 3.76, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-N-(2-piperazin-1-ylethyl)ethanamine is sourced from PubChem (CID 3129766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).