C19H26N2 — CID 3129770
5-methyl-2-phenyl-3-(2,6,6-trimethylcyclohexen-1-yl)-3,4-dihydropyrazole (PubChem CID 3129770) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 5-methyl-2-phenyl-3-(2,6,6-trimethylcyclohexen-1-yl)-3,4-dihydropyrazole.
| Compound Name | 5-methyl-2-phenyl-3-(2,6,6-trimethylcyclohexen-1-yl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 3129770 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 5-methyl-2-phenyl-3-(2,6,6-trimethylcyclohexen-1-yl)-3,4-dihydropyrazole |
| SMILES | CC1=NN(c2ccccc2)C(C2=C(C)CCCC2(C)C)C1 |
| InChI | InChI=1S/C19H26N2/c1-14-9-8-12-19(3,4)18(14)17-13-15(2)20-21(17)16-10-6-5-7-11-16/h5-7,10-11,17H,8-9,12-13H2,1-4H3 |
| InChIKey | DQTBDIZFJXQAHL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|