C13H20ClN7O — CID 3130267
2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-diethylpropanamide (PubChem CID 3130267) has the molecular formula C13H20ClN7O and a molecular weight of 325.80 g/mol. Its IUPAC name is 2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-diethylpropanamide.
| Compound Name | 2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 3130267 |
| Molecular Formula | C13H20ClN7O |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)N(C#N)c1nc(Cl)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H20ClN7O/c1-6-20(7-2)10(22)9(3)21(8-15)13-17-11(14)16-12(18-13)19(4)5/h9H,6-7H2,1-5H3 |
| InChIKey | CQBGETICMZFUPO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 89.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|