About 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-diethylpropanamide
2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-diethylpropanamide (PubChem CID 3130268) has the molecular formula C14H21N5O
and a molecular weight of 275.36 g/mol. Its IUPAC name is 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-diethylpropanamide |
| PubChem CID | 3130268 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)N(C#N)c1nc(C)cc(C)n1 |
| InChI | InChI=1S/C14H21N5O/c1-6-18(7-2)13(20)12(5)19(9-15)14-16-10(3)8-11(4)17-14/h8,12H,6-7H2,1-5H3 |
| InChIKey | GBVUGEAFZRCMRF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-diethylpropanamide?
The IUPAC name of 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-diethylpropanamide (CID 3130268) is 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-diethylpropanamide.
What is the SMILES notation for 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-diethylpropanamide?
The canonical SMILES for 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-diethylpropanamide is CCN(CC)C(=O)C(C)N(C#N)c1nc(C)cc(C)n1.
What is the InChIKey of 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-diethylpropanamide?
The InChIKey is GBVUGEAFZRCMRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5O/c1-6-18(7-2)13(20)12(5)19(9-15)14-16-10(3)8-11(4)17-14/h8,12H,6-7H2,1-5H3.
What are the key properties of 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-diethylpropanamide?
2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-diethylpropanamide has a molecular weight of 275.36 g/mol, XLogP of 1.64, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N,N-diethylpropanamide is sourced from PubChem (CID 3130268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).