C16H16N4O2 — CID 31303371
(2,4-dimethylphenyl) 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 31303371) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is (2,4-dimethylphenyl) 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | (2,4-dimethylphenyl) 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 31303371 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2,4-dimethylphenyl) 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)c2nc3nc(C)cc(C)n3n2)c(C)c1 |
| InChI | InChI=1S/C16H16N4O2/c1-9-5-6-13(10(2)7-9)22-15(21)14-18-16-17-11(3)8-12(4)20(16)19-14/h5-8H,1-4H3 |
| InChIKey | RURVZNRMABTGDK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|