C22H16N2O9 — CID 3130477
3-[5-[2-(2-carboxyethyl)-1,3-dioxoisoindol-5-yl]oxy-1,3-dioxoisoindol-2-yl]propanoic acid (PubChem CID 3130477) has the molecular formula C22H16N2O9 and a molecular weight of 452.38 g/mol. Its IUPAC name is 3-[5-[2-(2-carboxyethyl)-1,3-dioxoisoindol-5-yl]oxy-1,3-dioxoisoindol-2-yl]propanoic acid.
| Compound Name | 3-[5-[2-(2-carboxyethyl)-1,3-dioxoisoindol-5-yl]oxy-1,3-dioxoisoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 3130477 |
| Molecular Formula | C22H16N2O9 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 3-[5-[2-(2-carboxyethyl)-1,3-dioxoisoindol-5-yl]oxy-1,3-dioxoisoindol-2-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)c2ccc(Oc3ccc4c(c3)C(=O)N(CCC(=O)O)C4=O)cc2C1=O |
| InChI | InChI=1S/C22H16N2O9/c25-17(26)5-7-23-19(29)13-3-1-11(9-15(13)21(23)31)33-12-2-4-14-16(10-12)22(32)24(20(14)30)8-6-18(27)28/h1-4,9-10H,5-8H2,(H,25,26)(H,27,28) |
| InChIKey | CJNSGGYBLPWMMO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 158.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|