About 1-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-6-oxopyridazine-3-carboxamide
1-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-6-oxopyridazine-3-carboxamide (PubChem CID 31304889) has the molecular formula C10H10N4O2S
and a molecular weight of 250.28 g/mol. Its IUPAC name is 1-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-6-oxopyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 1-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-6-oxopyridazine-3-carboxamide |
| PubChem CID | 31304889 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 1-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-6-oxopyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)/N=c2\sccn2C)ccc1=O |
| InChI | InChI=1S/C10H10N4O2S/c1-13-5-6-17-10(13)11-9(16)7-3-4-8(15)14(2)12-7/h3-6H,1-2H3/b11-10- |
| InChIKey | BWXGUTKUWKDHHH-KHPPLWFESA-N |
| XLogP | -0.08 |
| TPSA | 69.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-6-oxopyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-6-oxopyridazine-3-carboxamide?
The IUPAC name of 1-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-6-oxopyridazine-3-carboxamide (CID 31304889) is 1-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-6-oxopyridazine-3-carboxamide.
What is the SMILES notation for 1-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-6-oxopyridazine-3-carboxamide?
The canonical SMILES for 1-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-6-oxopyridazine-3-carboxamide is Cn1nc(C(=O)/N=c2\sccn2C)ccc1=O.
What is the InChIKey of 1-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-6-oxopyridazine-3-carboxamide?
The InChIKey is BWXGUTKUWKDHHH-KHPPLWFESA-N. The full InChI is InChI=1S/C10H10N4O2S/c1-13-5-6-17-10(13)11-9(16)7-3-4-8(15)14(2)12-7/h3-6H,1-2H3/b11-10-.
What are the key properties of 1-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-6-oxopyridazine-3-carboxamide?
1-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-6-oxopyridazine-3-carboxamide has a molecular weight of 250.28 g/mol, XLogP of -0.08, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-6-oxopyridazine-3-carboxamide is sourced from PubChem (CID 31304889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).