C28H29NO2 — CID 3130893
10-(4-butylphenyl)-7,7-dimethyl-5,6,8,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione (PubChem CID 3130893) has the molecular formula C28H29NO2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 10-(4-butylphenyl)-7,7-dimethyl-5,6,8,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione.
| Compound Name | 10-(4-butylphenyl)-7,7-dimethyl-5,6,8,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
|---|---|
| PubChem CID | 3130893 |
| Molecular Formula | C28H29NO2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 10-(4-butylphenyl)-7,7-dimethyl-5,6,8,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
| SMILES | CCCCc1ccc(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)c2ccccc23)cc1 |
| InChI | InChI=1S/C28H29NO2/c1-4-5-8-17-11-13-18(14-12-17)23-24-21(15-28(2,3)16-22(24)30)29-26-19-9-6-7-10-20(19)27(31)25(23)26/h6-7,9-14,23,29H,4-5,8,15-16H2,1-3H3 |
| InChIKey | ZNUZBVIMLQUXBZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |