C13H12N2O4 — CID 3131057
3a,8b-dihydroxy-1-prop-2-enyl-3H-indeno[1,2-d]imidazole-2,4-dione (PubChem CID 3131057) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 3a,8b-dihydroxy-1-prop-2-enyl-3H-indeno[1,2-d]imidazole-2,4-dione.
| Compound Name | 3a,8b-dihydroxy-1-prop-2-enyl-3H-indeno[1,2-d]imidazole-2,4-dione |
|---|---|
| PubChem CID | 3131057 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3a,8b-dihydroxy-1-prop-2-enyl-3H-indeno[1,2-d]imidazole-2,4-dione |
| SMILES | C=CCN1C(=O)NC2(O)C(=O)c3ccccc3C12O |
| InChI | InChI=1S/C13H12N2O4/c1-2-7-15-11(17)14-12(18)10(16)8-5-3-4-6-9(8)13(12,15)19/h2-6,18-19H,1,7H2,(H,14,17) |
| InChIKey | NQIRCSRKAXWQMR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|