About 2,7-bis[(3,5-dimethylpiperidin-1-yl)sulfonyl]fluoren-9-one
2,7-bis[(3,5-dimethylpiperidin-1-yl)sulfonyl]fluoren-9-one (PubChem CID 3131230) has the molecular formula C27H34N2O5S2
and a molecular weight of 530.71 g/mol. Its IUPAC name is 2,7-bis[(3,5-dimethylpiperidin-1-yl)sulfonyl]fluoren-9-one.
Molecular Properties
| Compound Name | 2,7-bis[(3,5-dimethylpiperidin-1-yl)sulfonyl]fluoren-9-one |
| PubChem CID | 3131230 |
| Molecular Formula | C27H34N2O5S2 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 2,7-bis[(3,5-dimethylpiperidin-1-yl)sulfonyl]fluoren-9-one |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc3c(c2)C(=O)c2cc(S(=O)(=O)N4CC(C)CC(C)C4)ccc2-3)C1 |
| InChI | InChI=1S/C27H34N2O5S2/c1-17-9-18(2)14-28(13-17)35(31,32)21-5-7-23-24-8-6-22(12-26(24)27(30)25(23)11-21)36(33,34)29-15-19(3)10-20(4)16-29/h5-8,11-12,17-20H,9-10,13-16H2,1-4H3 |
| InChIKey | SMZIWKQMKPNDNI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,7-bis[(3,5-dimethylpiperidin-1-yl)sulfonyl]fluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-bis[(3,5-dimethylpiperidin-1-yl)sulfonyl]fluoren-9-one?
The IUPAC name of 2,7-bis[(3,5-dimethylpiperidin-1-yl)sulfonyl]fluoren-9-one (CID 3131230) is 2,7-bis[(3,5-dimethylpiperidin-1-yl)sulfonyl]fluoren-9-one.
What is the SMILES notation for 2,7-bis[(3,5-dimethylpiperidin-1-yl)sulfonyl]fluoren-9-one?
The canonical SMILES for 2,7-bis[(3,5-dimethylpiperidin-1-yl)sulfonyl]fluoren-9-one is CC1CC(C)CN(S(=O)(=O)c2ccc3c(c2)C(=O)c2cc(S(=O)(=O)N4CC(C)CC(C)C4)ccc2-3)C1.
What is the InChIKey of 2,7-bis[(3,5-dimethylpiperidin-1-yl)sulfonyl]fluoren-9-one?
The InChIKey is SMZIWKQMKPNDNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H34N2O5S2/c1-17-9-18(2)14-28(13-17)35(31,32)21-5-7-23-24-8-6-22(12-26(24)27(30)25(23)11-21)36(33,34)29-15-19(3)10-20(4)16-29/h5-8,11-12,17-20H,9-10,13-16H2,1-4H3.
What are the key properties of 2,7-bis[(3,5-dimethylpiperidin-1-yl)sulfonyl]fluoren-9-one?
2,7-bis[(3,5-dimethylpiperidin-1-yl)sulfonyl]fluoren-9-one has a molecular weight of 530.71 g/mol, XLogP of 4.23, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-bis[(3,5-dimethylpiperidin-1-yl)sulfonyl]fluoren-9-one is sourced from PubChem (CID 3131230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).