C26H19N5O4S2 — CID 3131532
5-[(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl)-pyridin-4-ylmethyl]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 3131532) has the molecular formula C26H19N5O4S2 and a molecular weight of 529.60 g/mol. Its IUPAC name is 5-[(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl)-pyridin-4-ylmethyl]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl)-pyridin-4-ylmethyl]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 3131532 |
| Molecular Formula | C26H19N5O4S2 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | 5-[(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl)-pyridin-4-ylmethyl]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(c2ccccc2)C(=O)C1C(c1ccncc1)C1C(=O)NC(=S)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C26H19N5O4S2/c32-21-19(23(34)30(25(36)28-21)16-7-3-1-4-8-16)18(15-11-13-27-14-12-15)20-22(33)29-26(37)31(24(20)35)17-9-5-2-6-10-17/h1-14,18-20H,(H,28,32,36)(H,29,33,37) |
| InChIKey | SFTHIVFUILROAK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|