C13H16ClN5O2 — CID 3132067
2-[[4-chloro-6-(4-ethoxyanilino)-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 3132067) has the molecular formula C13H16ClN5O2 and a molecular weight of 309.76 g/mol. Its IUPAC name is 2-[[4-chloro-6-(4-ethoxyanilino)-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-chloro-6-(4-ethoxyanilino)-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 3132067 |
| Molecular Formula | C13H16ClN5O2 |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[[4-chloro-6-(4-ethoxyanilino)-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | CCOc1ccc(Nc2nc(Cl)nc(NCCO)n2)cc1 |
| InChI | InChI=1S/C13H16ClN5O2/c1-2-21-10-5-3-9(4-6-10)16-13-18-11(14)17-12(19-13)15-7-8-20/h3-6,20H,2,7-8H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | SWRDNBAIUYKSCU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |