C19H24N2O5S2 — CID 31323268
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]acetamide (PubChem CID 31323268) has the molecular formula C19H24N2O5S2 and a molecular weight of 424.54 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 31323268 |
| Molecular Formula | C19H24N2O5S2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]acetamide |
| SMILES | C=CCN(CC(=O)NCCc1ccc(OC)c(OC)c1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H24N2O5S2/c1-4-11-21(28(23,24)19-6-5-12-27-19)14-18(22)20-10-9-15-7-8-16(25-2)17(13-15)26-3/h4-8,12-13H,1,9-11,14H2,2-3H3,(H,20,22) |
| InChIKey | PGIVCNZOLLBGOT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|