C18H18N10O3 — CID 3132776
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-hydroxy-1H-indol-3-yl)imino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide (PubChem CID 3132776) has the molecular formula C18H18N10O3 and a molecular weight of 422.41 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-hydroxy-1H-indol-3-yl)imino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-hydroxy-1H-indol-3-yl)imino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 3132776 |
| Molecular Formula | C18H18N10O3 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-hydroxy-1H-indol-3-yl)imino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)/N=N/c2c(O)[nH]c3ccccc23)c1CN1CCCC1 |
| InChI | InChI=1S/C18H18N10O3/c19-15-16(25-31-24-15)28-12(9-27-7-3-4-8-27)14(22-26-28)18(30)23-21-13-10-5-1-2-6-11(10)20-17(13)29/h1-2,5-6,20,29H,3-4,7-9H2,(H2,19,24)/b23-21+ |
| InChIKey | PJDSOFASYWTAEL-XTQSDGFTSA-N |
| XLogP | 1.94 |
| TPSA | 176.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|