C16H23N5OS2 — CID 31328637
2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 31328637) has the molecular formula C16H23N5OS2 and a molecular weight of 365.53 g/mol. Its IUPAC name is 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 31328637 |
| Molecular Formula | C16H23N5OS2 |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C16H23N5OS2/c1-2-4-14-17-18-16(23)21(14)12-15(22)20-8-6-19(7-9-20)11-13-5-3-10-24-13/h3,5,10H,2,4,6-9,11-12H2,1H3,(H,18,23) |
| InChIKey | XWGNKDRZEVJXPL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|