C17H17IN2O2S — CID 31330561
2-iodo-N-[2-oxo-2-[prop-2-enyl(thiophen-2-ylmethyl)amino]ethyl]benzamide (PubChem CID 31330561) has the molecular formula C17H17IN2O2S and a molecular weight of 440.31 g/mol. Its IUPAC name is 2-iodo-N-[2-oxo-2-[prop-2-enyl(thiophen-2-ylmethyl)amino]ethyl]benzamide.
| Compound Name | 2-iodo-N-[2-oxo-2-[prop-2-enyl(thiophen-2-ylmethyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 31330561 |
| Molecular Formula | C17H17IN2O2S |
| Molecular Weight | 440.31 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | 2-iodo-N-[2-oxo-2-[prop-2-enyl(thiophen-2-ylmethyl)amino]ethyl]benzamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)CNC(=O)c1ccccc1I |
| InChI | InChI=1S/C17H17IN2O2S/c1-2-9-20(12-13-6-5-10-23-13)16(21)11-19-17(22)14-7-3-4-8-15(14)18/h2-8,10H,1,9,11-12H2,(H,19,22) |
| InChIKey | GISLTWKZRNBHMT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|