C24H27NO4 — CID 3133179
1-[3-acetyl-4-anilino-6-hydroxy-2-(4-methoxyphenyl)-6-methylcyclohex-3-en-1-yl]ethanone (PubChem CID 3133179) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 1-[3-acetyl-4-anilino-6-hydroxy-2-(4-methoxyphenyl)-6-methylcyclohex-3-en-1-yl]ethanone.
| Compound Name | 1-[3-acetyl-4-anilino-6-hydroxy-2-(4-methoxyphenyl)-6-methylcyclohex-3-en-1-yl]ethanone |
|---|---|
| PubChem CID | 3133179 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-[3-acetyl-4-anilino-6-hydroxy-2-(4-methoxyphenyl)-6-methylcyclohex-3-en-1-yl]ethanone |
| SMILES | COc1ccc(C2C(C(C)=O)=C(Nc3ccccc3)CC(C)(O)C2C(C)=O)cc1 |
| InChI | InChI=1S/C24H27NO4/c1-15(26)21-20(25-18-8-6-5-7-9-18)14-24(3,28)23(16(2)27)22(21)17-10-12-19(29-4)13-11-17/h5-13,22-23,25,28H,14H2,1-4H3 |
| InChIKey | VVHLLIDVSGDNCN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |