C12H10N4O4 — CID 3133237
N-(2-methylphenyl)-3,5-dinitropyridin-4-amine (PubChem CID 3133237) has the molecular formula C12H10N4O4 and a molecular weight of 274.24 g/mol. Its IUPAC name is N-(2-methylphenyl)-3,5-dinitropyridin-4-amine.
| Compound Name | N-(2-methylphenyl)-3,5-dinitropyridin-4-amine |
|---|---|
| PubChem CID | 3133237 |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | N-(2-methylphenyl)-3,5-dinitropyridin-4-amine |
| SMILES | Cc1ccccc1Nc1c([N+](=O)[O-])cncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10N4O4/c1-8-4-2-3-5-9(8)14-12-10(15(17)18)6-13-7-11(12)16(19)20/h2-7H,1H3,(H,13,14) |
| InChIKey | PCKHMGNTBHSVJX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|