C20H17N7 — CID 3133614
6-(3-methyl-5-phenylpyrazol-1-yl)-N-(pyridin-3-ylmethylideneamino)pyrimidin-4-amine (PubChem CID 3133614) has the molecular formula C20H17N7 and a molecular weight of 355.41 g/mol. Its IUPAC name is 6-(3-methyl-5-phenylpyrazol-1-yl)-N-(pyridin-3-ylmethylideneamino)pyrimidin-4-amine.
| Compound Name | 6-(3-methyl-5-phenylpyrazol-1-yl)-N-(pyridin-3-ylmethylideneamino)pyrimidin-4-amine |
|---|---|
| PubChem CID | 3133614 |
| Molecular Formula | C20H17N7 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 6-(3-methyl-5-phenylpyrazol-1-yl)-N-(pyridin-3-ylmethylideneamino)pyrimidin-4-amine |
| SMILES | Cc1cc(-c2ccccc2)n(-c2cc(NN=Cc3cccnc3)ncn2)n1 |
| InChI | InChI=1S/C20H17N7/c1-15-10-18(17-7-3-2-4-8-17)27(26-15)20-11-19(22-14-23-20)25-24-13-16-6-5-9-21-12-16/h2-14H,1H3,(H,22,23,25) |
| InChIKey | DGPYTWZYBHQNIX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|