About N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-2-fluorobenzamide
N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-2-fluorobenzamide (PubChem CID 3134279) has the molecular formula C20H15BrFNO2S
and a molecular weight of 432.31 g/mol. Its IUPAC name is N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-2-fluorobenzamide.
Molecular Properties
| Compound Name | N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-2-fluorobenzamide |
| PubChem CID | 3134279 |
| Molecular Formula | C20H15BrFNO2S |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-2-fluorobenzamide |
| SMILES | Cc1sc(NC(=O)c2ccccc2F)c(C(=O)c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C20H15BrFNO2S/c1-11-12(2)26-20(23-19(25)15-5-3-4-6-16(15)22)17(11)18(24)13-7-9-14(21)10-8-13/h3-10H,1-2H3,(H,23,25) |
| InChIKey | ZCXHZKQPMJFBKL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-2-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-2-fluorobenzamide?
The IUPAC name of N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-2-fluorobenzamide (CID 3134279) is N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-2-fluorobenzamide.
What is the SMILES notation for N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-2-fluorobenzamide?
The canonical SMILES for N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-2-fluorobenzamide is Cc1sc(NC(=O)c2ccccc2F)c(C(=O)c2ccc(Br)cc2)c1C.
What is the InChIKey of N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-2-fluorobenzamide?
The InChIKey is ZCXHZKQPMJFBKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15BrFNO2S/c1-11-12(2)26-20(23-19(25)15-5-3-4-6-16(15)22)17(11)18(24)13-7-9-14(21)10-8-13/h3-10H,1-2H3,(H,23,25).
What are the key properties of N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-2-fluorobenzamide?
N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-2-fluorobenzamide has a molecular weight of 432.31 g/mol, XLogP of 5.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-2-fluorobenzamide is sourced from PubChem (CID 3134279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).