About (1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl) propanoate
(1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl) propanoate (PubChem CID 3134422) has the molecular formula C21H23NO3
and a molecular weight of 337.42 g/mol. Its IUPAC name is (1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl) propanoate.
Molecular Properties
| Compound Name | (1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl) propanoate |
| PubChem CID | 3134422 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl) propanoate |
| SMILES | CCC(=O)OC1CC(C)N(C(=O)c2ccccc2)c2ccc(C)cc21 |
| InChI | InChI=1S/C21H23NO3/c1-4-20(23)25-19-13-15(3)22(18-11-10-14(2)12-17(18)19)21(24)16-8-6-5-7-9-16/h5-12,15,19H,4,13H2,1-3H3 |
| InChIKey | NHMCUUWCWNYGQI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl) propanoate?
The IUPAC name of (1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl) propanoate (CID 3134422) is (1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl) propanoate.
What is the SMILES notation for (1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl) propanoate?
The canonical SMILES for (1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl) propanoate is CCC(=O)OC1CC(C)N(C(=O)c2ccccc2)c2ccc(C)cc21.
What is the InChIKey of (1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl) propanoate?
The InChIKey is NHMCUUWCWNYGQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO3/c1-4-20(23)25-19-13-15(3)22(18-11-10-14(2)12-17(18)19)21(24)16-8-6-5-7-9-16/h5-12,15,19H,4,13H2,1-3H3.
What are the key properties of (1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl) propanoate?
(1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl) propanoate has a molecular weight of 337.42 g/mol, XLogP of 4.43, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl) propanoate is sourced from PubChem (CID 3134422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).