About 7-ethoxy-3-N-(furan-2-ylmethyl)acridine-3,9-diamine
7-ethoxy-3-N-(furan-2-ylmethyl)acridine-3,9-diamine (PubChem CID 3135086) has the molecular formula C20H19N3O2
and a molecular weight of 333.39 g/mol. Its IUPAC name is 7-ethoxy-3-N-(furan-2-ylmethyl)acridine-3,9-diamine.
Molecular Properties
| Compound Name | 7-ethoxy-3-N-(furan-2-ylmethyl)acridine-3,9-diamine |
| PubChem CID | 3135086 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 7-ethoxy-3-N-(furan-2-ylmethyl)acridine-3,9-diamine |
| SMILES | CCOc1ccc2nc3cc(NCc4ccco4)ccc3c(N)c2c1 |
| InChI | InChI=1S/C20H19N3O2/c1-2-24-14-6-8-18-17(11-14)20(21)16-7-5-13(10-19(16)23-18)22-12-15-4-3-9-25-15/h3-11,22H,2,12H2,1H3,(H2,21,23) |
| InChIKey | PGNWQNJXXLPZEL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 7-ethoxy-3-N-(furan-2-ylmethyl)acridine-3,9-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-3-N-(furan-2-ylmethyl)acridine-3,9-diamine?
The IUPAC name of 7-ethoxy-3-N-(furan-2-ylmethyl)acridine-3,9-diamine (CID 3135086) is 7-ethoxy-3-N-(furan-2-ylmethyl)acridine-3,9-diamine.
What is the SMILES notation for 7-ethoxy-3-N-(furan-2-ylmethyl)acridine-3,9-diamine?
The canonical SMILES for 7-ethoxy-3-N-(furan-2-ylmethyl)acridine-3,9-diamine is CCOc1ccc2nc3cc(NCc4ccco4)ccc3c(N)c2c1.
What is the InChIKey of 7-ethoxy-3-N-(furan-2-ylmethyl)acridine-3,9-diamine?
The InChIKey is PGNWQNJXXLPZEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O2/c1-2-24-14-6-8-18-17(11-14)20(21)16-7-5-13(10-19(16)23-18)22-12-15-4-3-9-25-15/h3-11,22H,2,12H2,1H3,(H2,21,23).
What are the key properties of 7-ethoxy-3-N-(furan-2-ylmethyl)acridine-3,9-diamine?
7-ethoxy-3-N-(furan-2-ylmethyl)acridine-3,9-diamine has a molecular weight of 333.39 g/mol, XLogP of 4.57, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-3-N-(furan-2-ylmethyl)acridine-3,9-diamine is sourced from PubChem (CID 3135086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).