About N-[(1R)-1-(3,4-difluorophenyl)ethyl]-N-methyl-4-(2H-tetrazol-5-yl)benzamide
N-[(1R)-1-(3,4-difluorophenyl)ethyl]-N-methyl-4-(2H-tetrazol-5-yl)benzamide (PubChem CID 31350990) has the molecular formula C17H15F2N5O
and a molecular weight of 343.34 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-difluorophenyl)ethyl]-N-methyl-4-(2H-tetrazol-5-yl)benzamide.
Molecular Properties
| Compound Name | N-[(1R)-1-(3,4-difluorophenyl)ethyl]-N-methyl-4-(2H-tetrazol-5-yl)benzamide |
| PubChem CID | 31350990 |
| Molecular Formula | C17H15F2N5O |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-[(1R)-1-(3,4-difluorophenyl)ethyl]-N-methyl-4-(2H-tetrazol-5-yl)benzamide |
| SMILES | C[C@H](c1ccc(F)c(F)c1)N(C)C(=O)c1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C17H15F2N5O/c1-10(13-7-8-14(18)15(19)9-13)24(2)17(25)12-5-3-11(4-6-12)16-20-22-23-21-16/h3-10H,1-2H3,(H,20,21,22,23)/t10-/m1/s1 |
| InChIKey | FRBUCDQCFXAQIQ-SNVBAGLBSA-N |
| XLogP | 2.98 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1R)-1-(3,4-difluorophenyl)ethyl]-N-methyl-4-(2H-tetrazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-(3,4-difluorophenyl)ethyl]-N-methyl-4-(2H-tetrazol-5-yl)benzamide?
The IUPAC name of N-[(1R)-1-(3,4-difluorophenyl)ethyl]-N-methyl-4-(2H-tetrazol-5-yl)benzamide (CID 31350990) is N-[(1R)-1-(3,4-difluorophenyl)ethyl]-N-methyl-4-(2H-tetrazol-5-yl)benzamide.
What is the SMILES notation for N-[(1R)-1-(3,4-difluorophenyl)ethyl]-N-methyl-4-(2H-tetrazol-5-yl)benzamide?
The canonical SMILES for N-[(1R)-1-(3,4-difluorophenyl)ethyl]-N-methyl-4-(2H-tetrazol-5-yl)benzamide is C[C@H](c1ccc(F)c(F)c1)N(C)C(=O)c1ccc(-c2nn[nH]n2)cc1.
What is the InChIKey of N-[(1R)-1-(3,4-difluorophenyl)ethyl]-N-methyl-4-(2H-tetrazol-5-yl)benzamide?
The InChIKey is FRBUCDQCFXAQIQ-SNVBAGLBSA-N. The full InChI is InChI=1S/C17H15F2N5O/c1-10(13-7-8-14(18)15(19)9-13)24(2)17(25)12-5-3-11(4-6-12)16-20-22-23-21-16/h3-10H,1-2H3,(H,20,21,22,23)/t10-/m1/s1.
What are the key properties of N-[(1R)-1-(3,4-difluorophenyl)ethyl]-N-methyl-4-(2H-tetrazol-5-yl)benzamide?
N-[(1R)-1-(3,4-difluorophenyl)ethyl]-N-methyl-4-(2H-tetrazol-5-yl)benzamide has a molecular weight of 343.34 g/mol, XLogP of 2.98, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-(3,4-difluorophenyl)ethyl]-N-methyl-4-(2H-tetrazol-5-yl)benzamide is sourced from PubChem (CID 31350990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).