About 2-(2,6-dimethylmorpholin-4-yl)sulfonylanthracene-9,10-dione
2-(2,6-dimethylmorpholin-4-yl)sulfonylanthracene-9,10-dione (PubChem CID 3135972) has the molecular formula C20H19NO5S
and a molecular weight of 385.44 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)sulfonylanthracene-9,10-dione.
Molecular Properties
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)sulfonylanthracene-9,10-dione |
| PubChem CID | 3135972 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)sulfonylanthracene-9,10-dione |
| SMILES | CC1CN(S(=O)(=O)c2ccc3c(c2)C(=O)c2ccccc2C3=O)CC(C)O1 |
| InChI | InChI=1S/C20H19NO5S/c1-12-10-21(11-13(2)26-12)27(24,25)14-7-8-17-18(9-14)20(23)16-6-4-3-5-15(16)19(17)22/h3-9,12-13H,10-11H2,1-2H3 |
| InChIKey | HHZABILEXZVMKC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dimethylmorpholin-4-yl)sulfonylanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylmorpholin-4-yl)sulfonylanthracene-9,10-dione?
The IUPAC name of 2-(2,6-dimethylmorpholin-4-yl)sulfonylanthracene-9,10-dione (CID 3135972) is 2-(2,6-dimethylmorpholin-4-yl)sulfonylanthracene-9,10-dione.
What is the SMILES notation for 2-(2,6-dimethylmorpholin-4-yl)sulfonylanthracene-9,10-dione?
The canonical SMILES for 2-(2,6-dimethylmorpholin-4-yl)sulfonylanthracene-9,10-dione is CC1CN(S(=O)(=O)c2ccc3c(c2)C(=O)c2ccccc2C3=O)CC(C)O1.
What is the InChIKey of 2-(2,6-dimethylmorpholin-4-yl)sulfonylanthracene-9,10-dione?
The InChIKey is HHZABILEXZVMKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO5S/c1-12-10-21(11-13(2)26-12)27(24,25)14-7-8-17-18(9-14)20(23)16-6-4-3-5-15(16)19(17)22/h3-9,12-13H,10-11H2,1-2H3.
What are the key properties of 2-(2,6-dimethylmorpholin-4-yl)sulfonylanthracene-9,10-dione?
2-(2,6-dimethylmorpholin-4-yl)sulfonylanthracene-9,10-dione has a molecular weight of 385.44 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylmorpholin-4-yl)sulfonylanthracene-9,10-dione is sourced from PubChem (CID 3135972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).