About N,N'-di(butan-2-yl)oxamide
N,N'-di(butan-2-yl)oxamide (PubChem CID 3136336) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is N,N'-di(butan-2-yl)oxamide.
Molecular Properties
| Compound Name | N,N'-di(butan-2-yl)oxamide |
| PubChem CID | 3136336 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | N,N'-di(butan-2-yl)oxamide |
| SMILES | CCC(C)NC(=O)C(=O)NC(C)CC |
| InChI | InChI=1S/C10H20N2O2/c1-5-7(3)11-9(13)10(14)12-8(4)6-2/h7-8H,5-6H2,1-4H3,(H,11,13)(H,12,14) |
| InChIKey | GNIZLHCZGWGWHI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N,N'-di(butan-2-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-di(butan-2-yl)oxamide?
The IUPAC name of N,N'-di(butan-2-yl)oxamide (CID 3136336) is N,N'-di(butan-2-yl)oxamide.
What is the SMILES notation for N,N'-di(butan-2-yl)oxamide?
The canonical SMILES for N,N'-di(butan-2-yl)oxamide is CCC(C)NC(=O)C(=O)NC(C)CC.
What is the InChIKey of N,N'-di(butan-2-yl)oxamide?
The InChIKey is GNIZLHCZGWGWHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-5-7(3)11-9(13)10(14)12-8(4)6-2/h7-8H,5-6H2,1-4H3,(H,11,13)(H,12,14).
What are the key properties of N,N'-di(butan-2-yl)oxamide?
N,N'-di(butan-2-yl)oxamide has a molecular weight of 200.28 g/mol, XLogP of 0.82, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-di(butan-2-yl)oxamide is sourced from PubChem (CID 3136336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).