About N-(2-oxothiolan-3-yl)-2,2-diphenylacetamide
N-(2-oxothiolan-3-yl)-2,2-diphenylacetamide (PubChem CID 3136355) has the molecular formula C18H17NO2S
and a molecular weight of 311.41 g/mol. Its IUPAC name is N-(2-oxothiolan-3-yl)-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-(2-oxothiolan-3-yl)-2,2-diphenylacetamide |
| PubChem CID | 3136355 |
| Molecular Formula | C18H17NO2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-(2-oxothiolan-3-yl)-2,2-diphenylacetamide |
| SMILES | O=C1SCCC1NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H17NO2S/c20-17(19-15-11-12-22-18(15)21)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,19,20) |
| InChIKey | OHQVBBHTUGGVNK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze N-(2-oxothiolan-3-yl)-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-oxothiolan-3-yl)-2,2-diphenylacetamide?
The IUPAC name of N-(2-oxothiolan-3-yl)-2,2-diphenylacetamide (CID 3136355) is N-(2-oxothiolan-3-yl)-2,2-diphenylacetamide.
What is the SMILES notation for N-(2-oxothiolan-3-yl)-2,2-diphenylacetamide?
The canonical SMILES for N-(2-oxothiolan-3-yl)-2,2-diphenylacetamide is O=C1SCCC1NC(=O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(2-oxothiolan-3-yl)-2,2-diphenylacetamide?
The InChIKey is OHQVBBHTUGGVNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO2S/c20-17(19-15-11-12-22-18(15)21)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,19,20).
What are the key properties of N-(2-oxothiolan-3-yl)-2,2-diphenylacetamide?
N-(2-oxothiolan-3-yl)-2,2-diphenylacetamide has a molecular weight of 311.41 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-oxothiolan-3-yl)-2,2-diphenylacetamide is sourced from PubChem (CID 3136355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).