About N'-(3,4-dimethylphenyl)-N-(oxolan-2-ylmethyl)oxamide
N'-(3,4-dimethylphenyl)-N-(oxolan-2-ylmethyl)oxamide (PubChem CID 3136544) has the molecular formula C15H20N2O3
and a molecular weight of 276.34 g/mol. Its IUPAC name is N'-(3,4-dimethylphenyl)-N-(oxolan-2-ylmethyl)oxamide.
Molecular Properties
| Compound Name | N'-(3,4-dimethylphenyl)-N-(oxolan-2-ylmethyl)oxamide |
| PubChem CID | 3136544 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N'-(3,4-dimethylphenyl)-N-(oxolan-2-ylmethyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCC2CCCO2)cc1C |
| InChI | InChI=1S/C15H20N2O3/c1-10-5-6-12(8-11(10)2)17-15(19)14(18)16-9-13-4-3-7-20-13/h5-6,8,13H,3-4,7,9H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | YHNZOFJSWGMHLE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(3,4-dimethylphenyl)-N-(oxolan-2-ylmethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,4-dimethylphenyl)-N-(oxolan-2-ylmethyl)oxamide?
The IUPAC name of N'-(3,4-dimethylphenyl)-N-(oxolan-2-ylmethyl)oxamide (CID 3136544) is N'-(3,4-dimethylphenyl)-N-(oxolan-2-ylmethyl)oxamide.
What is the SMILES notation for N'-(3,4-dimethylphenyl)-N-(oxolan-2-ylmethyl)oxamide?
The canonical SMILES for N'-(3,4-dimethylphenyl)-N-(oxolan-2-ylmethyl)oxamide is Cc1ccc(NC(=O)C(=O)NCC2CCCO2)cc1C.
What is the InChIKey of N'-(3,4-dimethylphenyl)-N-(oxolan-2-ylmethyl)oxamide?
The InChIKey is YHNZOFJSWGMHLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-10-5-6-12(8-11(10)2)17-15(19)14(18)16-9-13-4-3-7-20-13/h5-6,8,13H,3-4,7,9H2,1-2H3,(H,16,18)(H,17,19).
What are the key properties of N'-(3,4-dimethylphenyl)-N-(oxolan-2-ylmethyl)oxamide?
N'-(3,4-dimethylphenyl)-N-(oxolan-2-ylmethyl)oxamide has a molecular weight of 276.34 g/mol, XLogP of 1.54, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,4-dimethylphenyl)-N-(oxolan-2-ylmethyl)oxamide is sourced from PubChem (CID 3136544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).