C16H13N3OS — CID 3136666
5'-(4-methylphenyl)spiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one (PubChem CID 3136666) has the molecular formula C16H13N3OS and a molecular weight of 295.37 g/mol. Its IUPAC name is 5'-(4-methylphenyl)spiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one.
| Compound Name | 5'-(4-methylphenyl)spiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one |
|---|---|
| PubChem CID | 3136666 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 5'-(4-methylphenyl)spiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one |
| SMILES | Cc1ccc(C2=NNC3(S2)C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C16H13N3OS/c1-10-6-8-11(9-7-10)14-18-19-16(21-14)12-4-2-3-5-13(12)17-15(16)20/h2-9,19H,1H3,(H,17,20) |
| InChIKey | BBMMLAFHBKDVAL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_5_B(2)', 'substructure': 'N/A'} |
|---|