About tert-butyl 2-[(2,6-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate
tert-butyl 2-[(2,6-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 3136692) has the molecular formula C18H26N2O3
and a molecular weight of 318.42 g/mol. Its IUPAC name is tert-butyl 2-[(2,6-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-[(2,6-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
| PubChem CID | 3136692 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | tert-butyl 2-[(2,6-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1cccc(C)c1NC(=O)C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26N2O3/c1-12-8-6-9-13(2)15(12)19-16(21)14-10-7-11-20(14)17(22)23-18(3,4)5/h6,8-9,14H,7,10-11H2,1-5H3,(H,19,21) |
| InChIKey | AKQGMGRLHJGDPJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 2-[(2,6-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(2,6-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl 2-[(2,6-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate (CID 3136692) is tert-butyl 2-[(2,6-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl 2-[(2,6-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl 2-[(2,6-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate is Cc1cccc(C)c1NC(=O)C1CCCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-[(2,6-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate?
The InChIKey is AKQGMGRLHJGDPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O3/c1-12-8-6-9-13(2)15(12)19-16(21)14-10-7-11-20(14)17(22)23-18(3,4)5/h6,8-9,14H,7,10-11H2,1-5H3,(H,19,21).
What are the key properties of tert-butyl 2-[(2,6-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate?
tert-butyl 2-[(2,6-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate has a molecular weight of 318.42 g/mol, XLogP of 3.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(2,6-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 3136692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).