C20H20F3N3O2 — CID 31370429
(E)-1-[4-(pyridin-4-ylmethyl)piperazin-1-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 31370429) has the molecular formula C20H20F3N3O2 and a molecular weight of 391.39 g/mol. Its IUPAC name is (E)-1-[4-(pyridin-4-ylmethyl)piperazin-1-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(pyridin-4-ylmethyl)piperazin-1-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 31370429 |
| Molecular Formula | C20H20F3N3O2 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (E)-1-[4-(pyridin-4-ylmethyl)piperazin-1-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OC(F)(F)F)cc1)N1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C20H20F3N3O2/c21-20(22,23)28-18-4-1-16(2-5-18)3-6-19(27)26-13-11-25(12-14-26)15-17-7-9-24-10-8-17/h1-10H,11-15H2/b6-3+ |
| InChIKey | PMYNERXVAMSODW-ZZXKWVIFSA-N |
| XLogP | 3.34 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|