C18H14N8O4 — CID 3137734
5,12-bis(1,2,4-triazol-4-yl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone (PubChem CID 3137734) has the molecular formula C18H14N8O4 and a molecular weight of 406.36 g/mol. Its IUPAC name is 5,12-bis(1,2,4-triazol-4-yl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone.
| Compound Name | 5,12-bis(1,2,4-triazol-4-yl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
|---|---|
| PubChem CID | 3137734 |
| Molecular Formula | C18H14N8O4 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 5,12-bis(1,2,4-triazol-4-yl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
| SMILES | O=C1C2C3C=CC(C2C(=O)N1n1cnnc1)C1C2C(=O)N(n4cnnc4)C(=O)C2C31 |
| InChI | InChI=1S/C18H14N8O4/c27-15-11-7-1-2-8(12(11)16(28)25(15)23-3-19-20-4-23)10-9(7)13-14(10)18(30)26(17(13)29)24-5-21-22-6-24/h1-14H |
| InChIKey | NNDVKFDKRSJNOX-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 136.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|