C18H16IN3O5S — CID 3137883
2-cyano-3-(3-ethoxy-4-hydroxy-5-iodophenyl)-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 3137883) has the molecular formula C18H16IN3O5S and a molecular weight of 513.31 g/mol. Its IUPAC name is 2-cyano-3-(3-ethoxy-4-hydroxy-5-iodophenyl)-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-(3-ethoxy-4-hydroxy-5-iodophenyl)-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3137883 |
| Molecular Formula | C18H16IN3O5S |
| Molecular Weight | 513.31 g/mol |
| Exact Mass | 512.99 |
| IUPAC Name | 2-cyano-3-(3-ethoxy-4-hydroxy-5-iodophenyl)-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc(I)c1O |
| InChI | InChI=1S/C18H16IN3O5S/c1-2-27-16-9-11(8-15(19)17(16)23)7-12(10-20)18(24)22-13-3-5-14(6-4-13)28(21,25)26/h3-9,23H,2H2,1H3,(H,22,24)(H2,21,25,26) |
| InChIKey | PJZVGQUOYVWZMR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 142.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|