About 4-(1-amino-2-phenylethyl)hepta-1,6-dien-4-ol
4-(1-amino-2-phenylethyl)hepta-1,6-dien-4-ol (PubChem CID 3138071) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is 4-(1-amino-2-phenylethyl)hepta-1,6-dien-4-ol.
Molecular Properties
| Compound Name | 4-(1-amino-2-phenylethyl)hepta-1,6-dien-4-ol |
| PubChem CID | 3138071 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 4-(1-amino-2-phenylethyl)hepta-1,6-dien-4-ol |
| SMILES | C=CCC(O)(CC=C)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C15H21NO/c1-3-10-15(17,11-4-2)14(16)12-13-8-6-5-7-9-13/h3-9,14,17H,1-2,10-12,16H2 |
| InChIKey | XPQQEJWDGKNROZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-amino-2-phenylethyl)hepta-1,6-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-amino-2-phenylethyl)hepta-1,6-dien-4-ol?
The IUPAC name of 4-(1-amino-2-phenylethyl)hepta-1,6-dien-4-ol (CID 3138071) is 4-(1-amino-2-phenylethyl)hepta-1,6-dien-4-ol.
What is the SMILES notation for 4-(1-amino-2-phenylethyl)hepta-1,6-dien-4-ol?
The canonical SMILES for 4-(1-amino-2-phenylethyl)hepta-1,6-dien-4-ol is C=CCC(O)(CC=C)C(N)Cc1ccccc1.
What is the InChIKey of 4-(1-amino-2-phenylethyl)hepta-1,6-dien-4-ol?
The InChIKey is XPQQEJWDGKNROZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c1-3-10-15(17,11-4-2)14(16)12-13-8-6-5-7-9-13/h3-9,14,17H,1-2,10-12,16H2.
What are the key properties of 4-(1-amino-2-phenylethyl)hepta-1,6-dien-4-ol?
4-(1-amino-2-phenylethyl)hepta-1,6-dien-4-ol has a molecular weight of 231.34 g/mol, XLogP of 2.44, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-amino-2-phenylethyl)hepta-1,6-dien-4-ol is sourced from PubChem (CID 3138071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).