C9H18N6O — CID 3138159
2-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 3138159) has the molecular formula C9H18N6O and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 3138159 |
| Molecular Formula | C9H18N6O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 2-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | CCNc1nc(NCC)nc(NCCO)n1 |
| InChI | InChI=1S/C9H18N6O/c1-3-10-7-13-8(11-4-2)15-9(14-7)12-5-6-16/h16H,3-6H2,1-2H3,(H3,10,11,12,13,14,15) |
| InChIKey | PWMAUNCPDJKPMM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |