C25H27NO4 — CID 3138775
butyl 4-(furan-2-yl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 3138775) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is butyl 4-(furan-2-yl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | butyl 4-(furan-2-yl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 3138775 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | butyl 4-(furan-2-yl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCCCOC(=O)C1=C(C)NC2=C(C(=O)CC(c3ccccc3)C2)C1c1ccco1 |
| InChI | InChI=1S/C25H27NO4/c1-3-4-12-30-25(28)22-16(2)26-19-14-18(17-9-6-5-7-10-17)15-20(27)23(19)24(22)21-11-8-13-29-21/h5-11,13,18,24,26H,3-4,12,14-15H2,1-2H3 |
| InChIKey | HJEOGJWDUXEFOQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|