About [2-(benzylcarbamoyl)phenyl] 2-bromobenzenesulfonate
[2-(benzylcarbamoyl)phenyl] 2-bromobenzenesulfonate (PubChem CID 31391053) has the molecular formula C20H16BrNO4S
and a molecular weight of 446.32 g/mol. Its IUPAC name is [2-(benzylcarbamoyl)phenyl] 2-bromobenzenesulfonate.
Molecular Properties
| Compound Name | [2-(benzylcarbamoyl)phenyl] 2-bromobenzenesulfonate |
| PubChem CID | 31391053 |
| Molecular Formula | C20H16BrNO4S |
| Molecular Weight | 446.32 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | [2-(benzylcarbamoyl)phenyl] 2-bromobenzenesulfonate |
| SMILES | O=C(NCc1ccccc1)c1ccccc1OS(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C20H16BrNO4S/c21-17-11-5-7-13-19(17)27(24,25)26-18-12-6-4-10-16(18)20(23)22-14-15-8-2-1-3-9-15/h1-13H,14H2,(H,22,23) |
| InChIKey | LMRPHWTYNSRFCJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(benzylcarbamoyl)phenyl] 2-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(benzylcarbamoyl)phenyl] 2-bromobenzenesulfonate?
The IUPAC name of [2-(benzylcarbamoyl)phenyl] 2-bromobenzenesulfonate (CID 31391053) is [2-(benzylcarbamoyl)phenyl] 2-bromobenzenesulfonate.
What is the SMILES notation for [2-(benzylcarbamoyl)phenyl] 2-bromobenzenesulfonate?
The canonical SMILES for [2-(benzylcarbamoyl)phenyl] 2-bromobenzenesulfonate is O=C(NCc1ccccc1)c1ccccc1OS(=O)(=O)c1ccccc1Br.
What is the InChIKey of [2-(benzylcarbamoyl)phenyl] 2-bromobenzenesulfonate?
The InChIKey is LMRPHWTYNSRFCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16BrNO4S/c21-17-11-5-7-13-19(17)27(24,25)26-18-12-6-4-10-16(18)20(23)22-14-15-8-2-1-3-9-15/h1-13H,14H2,(H,22,23).
What are the key properties of [2-(benzylcarbamoyl)phenyl] 2-bromobenzenesulfonate?
[2-(benzylcarbamoyl)phenyl] 2-bromobenzenesulfonate has a molecular weight of 446.32 g/mol, XLogP of 4.15, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(benzylcarbamoyl)phenyl] 2-bromobenzenesulfonate is sourced from PubChem (CID 31391053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).