C23H20ClN3O4 — CID 31392126
(2S)-2-(1,3-benzodioxol-5-ylamino)-1-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]propan-1-one (PubChem CID 31392126) has the molecular formula C23H20ClN3O4 and a molecular weight of 437.88 g/mol. Its IUPAC name is (2S)-2-(1,3-benzodioxol-5-ylamino)-1-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]propan-1-one.
| Compound Name | (2S)-2-(1,3-benzodioxol-5-ylamino)-1-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]propan-1-one |
|---|---|
| PubChem CID | 31392126 |
| Molecular Formula | C23H20ClN3O4 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | (2S)-2-(1,3-benzodioxol-5-ylamino)-1-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]propan-1-one |
| SMILES | C[C@H](Nc1ccc2c(c1)OCO2)C(=O)N1N=C(c2ccc(Cl)cc2)C[C@H]1c1ccco1 |
| InChI | InChI=1S/C23H20ClN3O4/c1-14(25-17-8-9-21-22(11-17)31-13-30-21)23(28)27-19(20-3-2-10-29-20)12-18(26-27)15-4-6-16(24)7-5-15/h2-11,14,19,25H,12-13H2,1H3/t14-,19-/m0/s1 |
| InChIKey | IDTRETYEYJRGPY-LIRRHRJNSA-N |
| XLogP | 4.84 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|