C13H23N3O3 — CID 3139316
2-[2-(cyclohexanecarbonyl)hydrazinyl]-N-(2-methylpropyl)-2-oxoacetamide (PubChem CID 3139316) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-[2-(cyclohexanecarbonyl)hydrazinyl]-N-(2-methylpropyl)-2-oxoacetamide.
| Compound Name | 2-[2-(cyclohexanecarbonyl)hydrazinyl]-N-(2-methylpropyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 3139316 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 2-[2-(cyclohexanecarbonyl)hydrazinyl]-N-(2-methylpropyl)-2-oxoacetamide |
| SMILES | CC(C)CNC(=O)C(=O)NNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C13H23N3O3/c1-9(2)8-14-12(18)13(19)16-15-11(17)10-6-4-3-5-7-10/h9-10H,3-8H2,1-2H3,(H,14,18)(H,15,17)(H,16,19) |
| InChIKey | IYRWIBQASZXOSM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|