About 4-bromo-2-[6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol
4-bromo-2-[6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol (PubChem CID 3139600) has the molecular formula C19H19Br2N3O6
and a molecular weight of 545.18 g/mol. Its IUPAC name is 4-bromo-2-[6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol.
Molecular Properties
| Compound Name | 4-bromo-2-[6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol |
| PubChem CID | 3139600 |
| Molecular Formula | C19H19Br2N3O6 |
| Molecular Weight | 545.18 g/mol |
| Exact Mass | 542.96 |
| IUPAC Name | 4-bromo-2-[6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol |
| SMILES | CC1(C)C([N+](=O)[O-])C(c2cc(Br)ccc2O)NC(c2cc(Br)ccc2O)C1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19Br2N3O6/c1-19(2)17(23(27)28)15(11-7-9(20)3-5-13(11)25)22-16(18(19)24(29)30)12-8-10(21)4-6-14(12)26/h3-8,15-18,22,25-26H,1-2H3 |
| InChIKey | LGUYRGFXQNABSG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 545.18 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-[6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-[6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol?
The IUPAC name of 4-bromo-2-[6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol (CID 3139600) is 4-bromo-2-[6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol.
What is the SMILES notation for 4-bromo-2-[6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol?
The canonical SMILES for 4-bromo-2-[6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol is CC1(C)C([N+](=O)[O-])C(c2cc(Br)ccc2O)NC(c2cc(Br)ccc2O)C1[N+](=O)[O-].
What is the InChIKey of 4-bromo-2-[6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol?
The InChIKey is LGUYRGFXQNABSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19Br2N3O6/c1-19(2)17(23(27)28)15(11-7-9(20)3-5-13(11)25)22-16(18(19)24(29)30)12-8-10(21)4-6-14(12)26/h3-8,15-18,22,25-26H,1-2H3.
What are the key properties of 4-bromo-2-[6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol?
4-bromo-2-[6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol has a molecular weight of 545.18 g/mol, XLogP of 4.33, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-[6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol is sourced from PubChem (CID 3139600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).