About 3-benzyl-2H-indazole
3-benzyl-2H-indazole (PubChem CID 3139604) has the molecular formula C14H12N2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-benzyl-2H-indazole.
Molecular Properties
| Compound Name | 3-benzyl-2H-indazole |
| PubChem CID | 3139604 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 3-benzyl-2H-indazole |
| SMILES | c1ccc(Cc2[nH]nc3ccccc23)cc1 |
| InChI | InChI=1S/C14H12N2/c1-2-6-11(7-3-1)10-14-12-8-4-5-9-13(12)15-16-14/h1-9H,10H2,(H,15,16) |
| InChIKey | XSFVAQRSZSENGO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-benzyl-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2H-indazole?
The IUPAC name of 3-benzyl-2H-indazole (CID 3139604) is 3-benzyl-2H-indazole.
What is the SMILES notation for 3-benzyl-2H-indazole?
The canonical SMILES for 3-benzyl-2H-indazole is c1ccc(Cc2[nH]nc3ccccc23)cc1.
What is the InChIKey of 3-benzyl-2H-indazole?
The InChIKey is XSFVAQRSZSENGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2/c1-2-6-11(7-3-1)10-14-12-8-4-5-9-13(12)15-16-14/h1-9H,10H2,(H,15,16).
What are the key properties of 3-benzyl-2H-indazole?
3-benzyl-2H-indazole has a molecular weight of 208.26 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2H-indazole is sourced from PubChem (CID 3139604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).