C12H16N2O — CID 3139698
2,2,4-trimethyl-6-nitroso-3,4-dihydro-1H-quinoline (PubChem CID 3139698) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2,2,4-trimethyl-6-nitroso-3,4-dihydro-1H-quinoline.
| Compound Name | 2,2,4-trimethyl-6-nitroso-3,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 3139698 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2,2,4-trimethyl-6-nitroso-3,4-dihydro-1H-quinoline |
| SMILES | CC1CC(C)(C)Nc2ccc(N=O)cc21 |
| InChI | InChI=1S/C12H16N2O/c1-8-7-12(2,3)13-11-5-4-9(14-15)6-10(8)11/h4-6,8,13H,7H2,1-3H3 |
| InChIKey | GDYNILYLBAKRLE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |