About 6,7-dinitroquinoxaline-2,3-dione
6,7-dinitroquinoxaline-2,3-dione (PubChem CID 3140) has the molecular formula C8H2N4O6
and a molecular weight of 250.13 g/mol. Its IUPAC name is 6,7-dinitroquinoxaline-2,3-dione.
Molecular Properties
| Compound Name | 6,7-dinitroquinoxaline-2,3-dione |
| PubChem CID | 3140 |
| Molecular Formula | C8H2N4O6 |
| Molecular Weight | 250.13 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 6,7-dinitroquinoxaline-2,3-dione |
| SMILES | O=C1N=c2cc([N+](=O)[O-])c([N+](=O)[O-])cc2=NC1=O |
| InChI | InChI=1S/C8H2N4O6/c13-7-8(14)10-4-2-6(12(17)18)5(11(15)16)1-3(4)9-7/h1-2H |
| InChIKey | YEUPBRRGMWBCEB-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 145.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.13 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dinitroquinoxaline-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dinitroquinoxaline-2,3-dione?
The IUPAC name of 6,7-dinitroquinoxaline-2,3-dione (CID 3140) is 6,7-dinitroquinoxaline-2,3-dione.
What is the SMILES notation for 6,7-dinitroquinoxaline-2,3-dione?
The canonical SMILES for 6,7-dinitroquinoxaline-2,3-dione is O=C1N=c2cc([N+](=O)[O-])c([N+](=O)[O-])cc2=NC1=O.
What is the InChIKey of 6,7-dinitroquinoxaline-2,3-dione?
The InChIKey is YEUPBRRGMWBCEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2N4O6/c13-7-8(14)10-4-2-6(12(17)18)5(11(15)16)1-3(4)9-7/h1-2H.
What are the key properties of 6,7-dinitroquinoxaline-2,3-dione?
6,7-dinitroquinoxaline-2,3-dione has a molecular weight of 250.13 g/mol, XLogP of -1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dinitroquinoxaline-2,3-dione is sourced from PubChem (CID 3140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).