C17H14N6O5S — CID 3140448
2-[[4-methyl-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide (PubChem CID 3140448) has the molecular formula C17H14N6O5S and a molecular weight of 414.40 g/mol. Its IUPAC name is 2-[[4-methyl-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[[4-methyl-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3140448 |
| Molecular Formula | C17H14N6O5S |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 2-[[4-methyl-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
| SMILES | Cn1c(SCC(=O)Nc2ccccc2[N+](=O)[O-])nnc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H14N6O5S/c1-21-16(11-6-8-12(9-7-11)22(25)26)19-20-17(21)29-10-15(24)18-13-4-2-3-5-14(13)23(27)28/h2-9H,10H2,1H3,(H,18,24) |
| InChIKey | SACSFUHQTUFJIK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 146.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|